상품명칭 |
에틸 3- 메틸 -5,6- 디 히드로 이미다 조 [2,1-b] [1,3] 티아 졸 -2- 카르 복실 레이트 염산염 |
별명 |
이미다 조 (2,1-b) 티아 졸 -2- 카르 복실 산, 5,6- 디 하이드로 -3- 메틸 -, 에틸 에스테르, 염산염; 3- 메틸 -5,6- 디 히드로 이미다 조 (2,1-b) 티아 졸 -2- 카르 복실 산 에틸 에스테르 염산염; 에틸 3- 메틸 -5,6- 디 하이드로 이미다 조 [2,1-b] [1,3] 티아 졸 -2- 카르 복실 레이트 염산염 (1 : 1) |
영문 이름 |
ethyl 3-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylate hydrochloride;Imidazo(2,1-b)thiazole-2-carboxylic acid, 5,6-dihydro-3-methyl-, ethyl ester, hydrochloride; 3-Methyl-5,6-dihydroimidazo(2,1-b)thiazole-2-carboxylic acid ethyl ester hydrochloride; ethyl 3-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylate hydrochloride (1:1) |
분자식 |
C9H13ClN2O2S |
분자량 |
248.7297 |
InChI |
InChI=1/C9H12N2O2S.ClH/c1-3-13-8(12)7-6(2)11-5-4-10-9(11)14-7;/h3-5H2,1-2H3;1H |
cas번호 |
34467-12-4 |
분자 구조 |
|
녹는 점 |
194℃ |
비등점 |
318.4°C at 760 mmHg |
인화점 |
146.3°C |
증기압 |
0.000363mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|